Compound Q&A

What precautions should be taken when handling Methyl 4-bromo-5-cyano-2-thiophenecarboxylate (CAS: 648412-60-6)?

Answer

Methyl 4-bromo-5-cyano-2-thiophenecarboxylate
Proper precautions include handling Methyl 4-bromo-5-cyano-2-thiophenecarboxylate in a fume hood to avoid exposure to its vapors. Wear appropriate personal protective equipment (PPE) such as gloves and safety goggles. Store the compound in a cool, well-ventilated area away from heat and ignition sources. In case of a spill, neutralize the material with a base if necessary, and dispose of it according to local regulations. Refer to the Safety Data Sheet (SDS) for detailed instructions.

About

English Name Methyl 4-bromo-5-cyano-2-thiophenecarboxylate
Molecular Formula C7H4BrNO2S
Molecular Weight 246.08 g/mol
SMILES COC(=O)C1=CC(=C(S1)C#N)Br
InChIKey CLUNERGOTORYPP-UHFFFAOYSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 4-bromo-5-cyano-2-thiophenecarboxylate (CAS: 648412-60-6)?

Methyl 4-bromo-5-cyano-2-thiophenecarboxylate is a crystalline compound with a molecular weight of a...

Compound Q&A

How is Methyl 4-bromo-5-cyano-2-thiophenecarboxylate (CAS: 648412-60-6) typically synthesized?

Methyl 4-bromo-5-cyano-2-thiophenecarboxylate is typically synthesized by reacting methyl thiophene-...

Compound Q&A

What industries use Methyl 4-bromo-5-cyano-2-thiophenecarboxylate (CAS: 648412-60-6)?

Methyl 4-bromo-5-cyano-2-thiophenecarboxylate is used in the pharmaceutical and fine chemical indust...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...