Compound Q&A

What industries use Methyl 4-bromo-5-cyano-2-thiophenecarboxylate (CAS: 648412-60-6)?

Answer

Methyl 4-bromo-5-cyano-2-thiophenecarboxylate
Methyl 4-bromo-5-cyano-2-thiophenecarboxylate is used in the pharmaceutical and fine chemical industries due to its reactivity and utility as an intermediate. It is also relevant in polymer chemistry for the synthesis of advanced materials and in sensor technology for specific chemical detection applications.

About

English Name Methyl 4-bromo-5-cyano-2-thiophenecarboxylate
Molecular Formula C7H4BrNO2S
Molecular Weight 246.08 g/mol
SMILES COC(=O)C1=CC(=C(S1)C#N)Br
InChIKey CLUNERGOTORYPP-UHFFFAOYSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 4-bromo-5-cyano-2-thiophenecarboxylate (CAS: 648412-60-6)?

Methyl 4-bromo-5-cyano-2-thiophenecarboxylate is a crystalline compound with a molecular weight of a...

Compound Q&A

How is Methyl 4-bromo-5-cyano-2-thiophenecarboxylate (CAS: 648412-60-6) typically synthesized?

Methyl 4-bromo-5-cyano-2-thiophenecarboxylate is typically synthesized by reacting methyl thiophene-...

Compound Q&A

What precautions should be taken when handling Methyl 4-bromo-5-cyano-2-thiophenecarboxylate (CAS: 648412-60-6)?

Proper precautions include handling Methyl 4-bromo-5-cyano-2-thiophenecarboxylate in a fume hood to ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...