Compound Q&A

What precautions should be taken when handling Methyl 3-(4-hydroxyphenyl)-4-hexynoate (CAS: 865234-02-2)?

Answer

Methyl 3-(4-hydroxyphenyl)-4-hexynoate
When handling Methyl 3-(4-hydroxyphenyl)-4-hexynoate, it is crucial to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. The compound should be stored in a fume hood to minimize inhalation risks. In case of a spill, it should be carefully cleaned up using appropriate absorbent materials, and the area should be well-ventilated. Always refer to the Safety Data Sheet (SDS) for detailed handling and emergency procedures.

About

English Name Methyl 3-(4-hydroxyphenyl)-4-hexynoate
Molecular Formula C13H14O3
Molecular Weight 30.07 g/mol
SMILES CC#CC(C1=CC=C(O)C=C1)CC(OC)=O
InChIKey BENPHURJTUUUSX-UHFFFAOYSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 3-(4-hydroxyphenyl)-4-hexynoate (CAS: 865234-02-2)?

Methyl 3-(4-hydroxyphenyl)-4-hexynoate is a crystalline solid with a molecular weight of approximate...

Compound Q&A

How is Methyl 3-(4-hydroxyphenyl)-4-hexynoate (CAS: 865234-02-2) typically synthesized?

Methyl 3-(4-hydroxyphenyl)-4-hexynoate is typically synthesized via a Grignard reaction. The process...

Compound Q&A

What industries use Methyl 3-(4-hydroxyphenyl)-4-hexynoate (CAS: 865234-02-2)?

Methyl 3-(4-hydroxyphenyl)-4-hexynoate is used in various industries. It finds applications in the p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...