Compound Q&A

How is Methyl 3-(4-hydroxyphenyl)-4-hexynoate (CAS: 865234-02-2) typically synthesized?

Answer

Methyl 3-(4-hydroxyphenyl)-4-hexynoate
Methyl 3-(4-hydroxyphenyl)-4-hexynoate is typically synthesized via a Grignard reaction. The process involves the formation of a Grignard reagent from 4-hydroxybenzaldehyde and hexanoylmagnesium bromide, followed by esterification with methyl alcohol. Common catalysts and reagents include sodium hydride or lithium aluminum hydride to control the reactivity and selectivity. The reaction typically yields 80-90% of the desired product with minimal side products.

About

English Name Methyl 3-(4-hydroxyphenyl)-4-hexynoate
Molecular Formula C13H14O3
Molecular Weight 30.07 g/mol
SMILES CC#CC(C1=CC=C(O)C=C1)CC(OC)=O
InChIKey BENPHURJTUUUSX-UHFFFAOYSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 3-(4-hydroxyphenyl)-4-hexynoate (CAS: 865234-02-2)?

Methyl 3-(4-hydroxyphenyl)-4-hexynoate is a crystalline solid with a molecular weight of approximate...

Compound Q&A

What industries use Methyl 3-(4-hydroxyphenyl)-4-hexynoate (CAS: 865234-02-2)?

Methyl 3-(4-hydroxyphenyl)-4-hexynoate is used in various industries. It finds applications in the p...

Compound Q&A

What precautions should be taken when handling Methyl 3-(4-hydroxyphenyl)-4-hexynoate (CAS: 865234-02-2)?

When handling Methyl 3-(4-hydroxyphenyl)-4-hexynoate, it is crucial to wear appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...