Compound Q&A

What industries use Methyl 3-(4-hydroxyphenyl)-4-hexynoate (CAS: 865234-02-2)?

Answer

Methyl 3-(4-hydroxyphenyl)-4-hexynoate
Methyl 3-(4-hydroxyphenyl)-4-hexynoate is used in various industries. It finds applications in the pharmaceutical industry as a precursor in the synthesis of certain drugs. It is also utilized in the polymer industry for the development of specific polymers with unique properties. Additionally, it is employed in the sensor industry due to its reactivity and in semiconductor manufacturing for specific chemical processes.

About

English Name Methyl 3-(4-hydroxyphenyl)-4-hexynoate
Molecular Formula C13H14O3
Molecular Weight 30.07 g/mol
SMILES CC#CC(C1=CC=C(O)C=C1)CC(OC)=O
InChIKey BENPHURJTUUUSX-UHFFFAOYSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 3-(4-hydroxyphenyl)-4-hexynoate (CAS: 865234-02-2)?

Methyl 3-(4-hydroxyphenyl)-4-hexynoate is a crystalline solid with a molecular weight of approximate...

Compound Q&A

How is Methyl 3-(4-hydroxyphenyl)-4-hexynoate (CAS: 865234-02-2) typically synthesized?

Methyl 3-(4-hydroxyphenyl)-4-hexynoate is typically synthesized via a Grignard reaction. The process...

Compound Q&A

What precautions should be taken when handling Methyl 3-(4-hydroxyphenyl)-4-hexynoate (CAS: 865234-02-2)?

When handling Methyl 3-(4-hydroxyphenyl)-4-hexynoate, it is crucial to wear appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...