Compound Q&A

What are the physical and chemical properties of Methyl 3-(4-hydroxyphenyl)-4-hexynoate (CAS: 865234-02-2)?

Answer

Methyl 3-(4-hydroxyphenyl)-4-hexynoate
Methyl 3-(4-hydroxyphenyl)-4-hexynoate is a crystalline solid with a molecular weight of approximately 212.23 g/mol. It is slightly soluble in water but highly soluble in organic solvents like ethanol and acetone. The compound is reactive, showing susceptibility to hydrolysis and oxidation under certain conditions. It has a melting point around 70-72°C and is stable under normal conditions but requires storage in a cool, dry place away from direct sunlight and oxidizing agents.

About

English Name Methyl 3-(4-hydroxyphenyl)-4-hexynoate
Molecular Formula C13H14O3
Molecular Weight 30.07 g/mol
SMILES CC#CC(C1=CC=C(O)C=C1)CC(OC)=O
InChIKey BENPHURJTUUUSX-UHFFFAOYSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

How is Methyl 3-(4-hydroxyphenyl)-4-hexynoate (CAS: 865234-02-2) typically synthesized?

Methyl 3-(4-hydroxyphenyl)-4-hexynoate is typically synthesized via a Grignard reaction. The process...

Compound Q&A

What industries use Methyl 3-(4-hydroxyphenyl)-4-hexynoate (CAS: 865234-02-2)?

Methyl 3-(4-hydroxyphenyl)-4-hexynoate is used in various industries. It finds applications in the p...

Compound Q&A

What precautions should be taken when handling Methyl 3-(4-hydroxyphenyl)-4-hexynoate (CAS: 865234-02-2)?

When handling Methyl 3-(4-hydroxyphenyl)-4-hexynoate, it is crucial to wear appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...