Compound Q&A

What industries use Cyclopropyl 5-bromo-2-chlorobenzamide (CAS: 669734-35-4)?

Answer

Cyclopropyl 5-bromo-2-chlorobenzamide
Cyclopropyl 5-bromo-2-chlorobenzamide (CAS: 669734-35-4) is used in the pharmaceutical and chemical industries for the development of novel compounds with specific functional groups. It may find applications in the synthesis of intermediates for drug development, as well as in materials science for the preparation of advanced polymers and other specialized chemicals.

About

English Name Cyclopropyl 5-bromo-2-chlorobenzamide
Molecular Formula C10H9BrClNO
Molecular Weight 274.55 g/mol
SMILES C1CC1NC(=O)C2=C(C=CC(=C2)Br)Cl
InChIKey HVXQTKXSRJBMDT-UHFFFAOYSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of Cyclopropyl 5-bromo-2-chlorobenzamide (CAS: 669734-35-4)?

Cyclopropyl 5-bromo-2-chlorobenzamide (CAS: 669734-35-4) is a crystalline solid with a molecular wei...

Compound Q&A

How is Cyclopropyl 5-bromo-2-chlorobenzamide (CAS: 669734-35-4) typically synthesized?

Cyclopropyl 5-bromo-2-chlorobenzamide can be synthesized through a multi-step reaction involving the...

Compound Q&A

What precautions should be taken when handling Cyclopropyl 5-bromo-2-chlorobenzamide (CAS: 669734-35-4)?

When handling Cyclopropyl 5-bromo-2-chlorobenzamide (CAS: 669734-35-4), it is essential to wear prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...