Compound Q&A

What are the physical and chemical properties of Cyclopropyl 5-bromo-2-chlorobenzamide (CAS: 669734-35-4)?

Answer

Cyclopropyl 5-bromo-2-chlorobenzamide
Cyclopropyl 5-bromo-2-chlorobenzamide (CAS: 669734-35-4) is a crystalline solid with a molecular weight of approximately 284.03 g/mol. It has a low solubility in water but is more soluble in organic solvents such as ethanol and acetone. The compound is relatively stable but can react with strong bases. It is prone to hydrolysis and has limited reactivity under normal conditions.

About

English Name Cyclopropyl 5-bromo-2-chlorobenzamide
Molecular Formula C10H9BrClNO
Molecular Weight 274.55 g/mol
SMILES C1CC1NC(=O)C2=C(C=CC(=C2)Br)Cl
InChIKey HVXQTKXSRJBMDT-UHFFFAOYSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

How is Cyclopropyl 5-bromo-2-chlorobenzamide (CAS: 669734-35-4) typically synthesized?

Cyclopropyl 5-bromo-2-chlorobenzamide can be synthesized through a multi-step reaction involving the...

Compound Q&A

What industries use Cyclopropyl 5-bromo-2-chlorobenzamide (CAS: 669734-35-4)?

Cyclopropyl 5-bromo-2-chlorobenzamide (CAS: 669734-35-4) is used in the pharmaceutical and chemical ...

Compound Q&A

What precautions should be taken when handling Cyclopropyl 5-bromo-2-chlorobenzamide (CAS: 669734-35-4)?

When handling Cyclopropyl 5-bromo-2-chlorobenzamide (CAS: 669734-35-4), it is essential to wear prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...