Compound Q&A

How is Cyclopropyl 5-bromo-2-chlorobenzamide (CAS: 669734-35-4) typically synthesized?

Answer

Cyclopropyl 5-bromo-2-chlorobenzamide
Cyclopropyl 5-bromo-2-chlorobenzamide can be synthesized through a multi-step reaction involving the bromination and chlorination of a benzene ring, followed by the amidation of the resulting compound with cyclopropylamine. The reaction typically requires the use of reagents like N-bromosuccinimide (NBS) and N-chlorosuccinimide (NCS) as catalysts. The yield and selectivity can be enhanced with careful control of reaction conditions and the use of appropriate solvents.

About

English Name Cyclopropyl 5-bromo-2-chlorobenzamide
Molecular Formula C10H9BrClNO
Molecular Weight 274.55 g/mol
SMILES C1CC1NC(=O)C2=C(C=CC(=C2)Br)Cl
InChIKey HVXQTKXSRJBMDT-UHFFFAOYSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of Cyclopropyl 5-bromo-2-chlorobenzamide (CAS: 669734-35-4)?

Cyclopropyl 5-bromo-2-chlorobenzamide (CAS: 669734-35-4) is a crystalline solid with a molecular wei...

Compound Q&A

What industries use Cyclopropyl 5-bromo-2-chlorobenzamide (CAS: 669734-35-4)?

Cyclopropyl 5-bromo-2-chlorobenzamide (CAS: 669734-35-4) is used in the pharmaceutical and chemical ...

Compound Q&A

What precautions should be taken when handling Cyclopropyl 5-bromo-2-chlorobenzamide (CAS: 669734-35-4)?

When handling Cyclopropyl 5-bromo-2-chlorobenzamide (CAS: 669734-35-4), it is essential to wear prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...