Compound Q&A

What industries use 4,4'-[(2-Methoxy-1,4-phenylene)di(E)-2,1-ethenediyl]diphenol (CAS: 863918-78-9)?

Answer

4,4'-[(2-Methoxy-1,4-phenylene)di(E)-2,1-ethenediyl]diphenol
4,4'-[(2-Methoxy-1,4-phenylene)di(E)-2,1-ethenediyl]diphenol is primarily used in the pharmaceutical industry for the development of novel drug candidates. It also finds applications in the production of paints and coatings as a colorant. Additionally, this compound is used in the manufacturing of electronic materials and sensors due to its unique chemical structure and properties.

About

English Name 4,4'-[(2-Methoxy-1,4-phenylene)di(E)-2,1-ethenediyl]diphenol
Molecular Formula C23H20O3
Molecular Weight 344.41 g/mol
SMILES COc1cc(ccc1/C=C/c2ccc(cc2)O)/C=C/c3ccc(cc3)O
InChIKey FGYNZFHVGOFCMD-KHVHPYDTSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4,4'-[(2-Methoxy-1,4-phenylene)di(E)-2,1-ethenediyl]diphenol (CAS: 863918-78-9)?

4,4'-[(2-Methoxy-1,4-phenylene)di(E)-2,1-ethenediyl]diphenol is a crystalline solid with a molecular...

Compound Q&A

How is 4,4'-[(2-Methoxy-1,4-phenylene)di(E)-2,1-ethenediyl]diphenol (CAS: 863918-78-9) typically synthesized?

4,4'-[(2-Methoxy-1,4-phenylene)di(E)-2,1-ethenediyl]diphenol can be synthesized through a multistep ...

Compound Q&A

What precautions should be taken when handling 4,4'-[(2-Methoxy-1,4-phenylene)di(E)-2,1-ethenediyl]diphenol (CAS: 863918-78-9)?

When handling 4,4'-[(2-Methoxy-1,4-phenylene)di(E)-2,1-ethenediyl]diphenol, it is essential to use p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...