Compound Q&A

What are the physical and chemical properties of 4,4'-[(2-Methoxy-1,4-phenylene)di(E)-2,1-ethenediyl]diphenol (CAS: 863918-78-9)?

Answer

4,4'-[(2-Methoxy-1,4-phenylene)di(E)-2,1-ethenediyl]diphenol
4,4'-[(2-Methoxy-1,4-phenylene)di(E)-2,1-ethenediyl]diphenol is a crystalline solid with a molecular weight of approximately 434.36 g/mol. It has low water solubility and moderate solubility in common organic solvents like dichloromethane and acetonitrile. This compound is relatively chemically stable but can react with strong acids and bases. Its reactivity is primarily influenced by the phenolic hydroxyl groups.

About

English Name 4,4'-[(2-Methoxy-1,4-phenylene)di(E)-2,1-ethenediyl]diphenol
Molecular Formula C23H20O3
Molecular Weight 344.41 g/mol
SMILES COc1cc(ccc1/C=C/c2ccc(cc2)O)/C=C/c3ccc(cc3)O
InChIKey FGYNZFHVGOFCMD-KHVHPYDTSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

How is 4,4'-[(2-Methoxy-1,4-phenylene)di(E)-2,1-ethenediyl]diphenol (CAS: 863918-78-9) typically synthesized?

4,4'-[(2-Methoxy-1,4-phenylene)di(E)-2,1-ethenediyl]diphenol can be synthesized through a multistep ...

Compound Q&A

What industries use 4,4'-[(2-Methoxy-1,4-phenylene)di(E)-2,1-ethenediyl]diphenol (CAS: 863918-78-9)?

4,4'-[(2-Methoxy-1,4-phenylene)di(E)-2,1-ethenediyl]diphenol is primarily used in the pharmaceutical...

Compound Q&A

What precautions should be taken when handling 4,4'-[(2-Methoxy-1,4-phenylene)di(E)-2,1-ethenediyl]diphenol (CAS: 863918-78-9)?

When handling 4,4'-[(2-Methoxy-1,4-phenylene)di(E)-2,1-ethenediyl]diphenol, it is essential to use p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...