Compound Q&A

What precautions should be taken when handling 5-[5-(2-Chloro-5-iodobenzyl)-2-thienyl]-2-fluoropyridine (CAS: 1131770-46-1)?

Answer

5-[5-(2-Chloro-5-iodobenzyl)-2-thienyl]-2-fluoropyridine
When handling 5-[5-(2-Chloro-5-iodobenzyl)-2-thienyl]-2-fluoropyridine, use personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Store in a cool, dry place away from direct sunlight. In case of a spill, use a spill kit, and consult the Safety Data Sheet (SDS) for specific guidelines. This compound requires fume hood use during synthesis due to its volatility and potential for generating toxic gases.

About

English Name 5-[5-(2-Chloro-5-iodobenzyl)-2-thienyl]-2-fluoropyridine
Molecular Formula C16H10ClFINS
Molecular Weight 429.69 g/mol
SMILES c1cc(c(cc1I)Cc2ccc(s2)c3ccc(nc3)F)Cl
InChIKey QMWRODWMUFMTIX-UHFFFAOYSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-[5-(2-Chloro-5-iodobenzyl)-2-thienyl]-2-fluoropyridine (CAS: 1131770-46-1)?

5-[5-(2-Chloro-5-iodobenzyl)-2-thienyl]-2-fluoropyridine has a crystalline form with a molecular wei...

Compound Q&A

How is 5-[5-(2-Chloro-5-iodobenzyl)-2-thienyl]-2-fluoropyridine (CAS: 1131770-46-1) typically synthesized?

5-[5-(2-Chloro-5-iodobenzyl)-2-thienyl]-2-fluoropyridine is synthesized via a multistep process invo...

Compound Q&A

What industries use 5-[5-(2-Chloro-5-iodobenzyl)-2-thienyl]-2-fluoropyridine (CAS: 1131770-46-1)?

This compound finds applications in pharmaceuticals, primarily as an intermediate in the synthesis o...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...