Compound Q&A

How is 5-[5-(2-Chloro-5-iodobenzyl)-2-thienyl]-2-fluoropyridine (CAS: 1131770-46-1) typically synthesized?

Answer

5-[5-(2-Chloro-5-iodobenzyl)-2-thienyl]-2-fluoropyridine
5-[5-(2-Chloro-5-iodobenzyl)-2-thienyl]-2-fluoropyridine is synthesized via a multistep process involving the coupling of 2-fluoropyridine with 2-chloro-5-iodobenzyl thioether, followed by the introduction of the thiophene ring. Commonly used catalysts include palladium(II) acetate in the presence of a ligand. The overall yield is typically around 60-70%.

About

English Name 5-[5-(2-Chloro-5-iodobenzyl)-2-thienyl]-2-fluoropyridine
Molecular Formula C16H10ClFINS
Molecular Weight 429.69 g/mol
SMILES c1cc(c(cc1I)Cc2ccc(s2)c3ccc(nc3)F)Cl
InChIKey QMWRODWMUFMTIX-UHFFFAOYSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-[5-(2-Chloro-5-iodobenzyl)-2-thienyl]-2-fluoropyridine (CAS: 1131770-46-1)?

5-[5-(2-Chloro-5-iodobenzyl)-2-thienyl]-2-fluoropyridine has a crystalline form with a molecular wei...

Compound Q&A

What industries use 5-[5-(2-Chloro-5-iodobenzyl)-2-thienyl]-2-fluoropyridine (CAS: 1131770-46-1)?

This compound finds applications in pharmaceuticals, primarily as an intermediate in the synthesis o...

Compound Q&A

What precautions should be taken when handling 5-[5-(2-Chloro-5-iodobenzyl)-2-thienyl]-2-fluoropyridine (CAS: 1131770-46-1)?

When handling 5-[5-(2-Chloro-5-iodobenzyl)-2-thienyl]-2-fluoropyridine, use personal protective equi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...