Compound Q&A

What industries use Norfloxacin lactate (CAS: 97867-34-0)?

Answer

Norfloxacin lactate
Norfloxacin lactate is primarily used in the pharmaceutical industry for the production of antibiotics. It is also used in research for its antimicrobial properties. This compound has potential applications in developing new drugs and in the field of antimicrobial resistance research.

About

CAS No 97867-34-0
English Name Norfloxacin lactate
Molecular Formula C19H24FN3O6
Molecular Weight 409.41 g/mol
SMILES CCN1C=C(C(=O)C2=CC(=C(C=C21)N3CCNCC3)F)C(=O)O.CC(C(=O)O)O
InChIKey AYEXIHJJZPTXSS-UHFFFAOYSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of Norfloxacin lactate (CAS: 97867-34-0)?

Norfloxacin lactate is a crystalline compound with a molecular weight of approximately 596.58 g/mol....

Compound Q&A

How is Norfloxacin lactate (CAS: 97867-34-0) typically synthesized?

Norfloxacin lactate is synthesized through a multi-step process involving acylation, ring formation,...

Compound Q&A

What precautions should be taken when handling Norfloxacin lactate (CAS: 97867-34-0)?

When handling Norfloxacin lactate, it is essential to wear appropriate personal protective equipment...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...