Compound Q&A

What are the physical and chemical properties of Norfloxacin lactate (CAS: 97867-34-0)?

Answer

Norfloxacin lactate
Norfloxacin lactate is a crystalline compound with a molecular weight of approximately 596.58 g/mol. It has a solubility of about 1.22 g/100 mL in water. Chemically, it is moderately reactive, particularly towards acidic and basic conditions. It is stable under normal storage conditions but should be protected from moisture and light.

About

CAS No 97867-34-0
English Name Norfloxacin lactate
Molecular Formula C19H24FN3O6
Molecular Weight 409.41 g/mol
SMILES CCN1C=C(C(=O)C2=CC(=C(C=C21)N3CCNCC3)F)C(=O)O.CC(C(=O)O)O
InChIKey AYEXIHJJZPTXSS-UHFFFAOYSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

How is Norfloxacin lactate (CAS: 97867-34-0) typically synthesized?

Norfloxacin lactate is synthesized through a multi-step process involving acylation, ring formation,...

Compound Q&A

What industries use Norfloxacin lactate (CAS: 97867-34-0)?

Norfloxacin lactate is primarily used in the pharmaceutical industry for the production of antibioti...

Compound Q&A

What precautions should be taken when handling Norfloxacin lactate (CAS: 97867-34-0)?

When handling Norfloxacin lactate, it is essential to wear appropriate personal protective equipment...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...