Compound Q&A

What precautions should be taken when handling [3-Chloro-5-(4-morpholinylcarbonyl)phenyl]boronic acid (CAS: 957120-55-7)?

Answer

[3-Chloro-5-(4-morpholinylcarbonyl)phenyl]boronic acid
When handling [3-Chloro-5-(4-morpholinylcarbonyl)phenyl]boronic acid, it is essential to use appropriate personal protective equipment (PPE) including gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or a fume hood. Spills should be cleaned up using appropriate cleaning agents and waste should be disposed of according to local regulations. Always consult the Safety Data Sheet (SDS) for specific handling and disposal instructions.

About

English Name [3-Chloro-5-(4-morpholinylcarbonyl)phenyl]boronic acid
Molecular Formula C11H13BClNO4
Molecular Weight 269.49 g/mol
SMILES B(C1=CC(=CC(=C1)Cl)C(=O)N2CCOCC2)(O)O
InChIKey ZXFMDBGQTVWQQY-UHFFFAOYSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of [3-Chloro-5-(4-morpholinylcarbonyl)phenyl]boronic acid (CAS: 957120-55-7)?

[3-Chloro-5-(4-morpholinylcarbonyl)phenyl]boronic acid is a crystalline solid with a molecular weigh...

Compound Q&A

How is [3-Chloro-5-(4-morpholinylcarbonyl)phenyl]boronic acid (CAS: 957120-55-7) typically synthesized?

[3-Chloro-5-(4-morpholinylcarbonyl)phenyl]boronic acid is typically synthesized by coupling 3-chloro...

Compound Q&A

What industries use [3-Chloro-5-(4-morpholinylcarbonyl)phenyl]boronic acid (CAS: 957120-55-7)?

[3-Chloro-5-(4-morpholinylcarbonyl)phenyl]boronic acid finds applications in various industries, par...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...