Compound Q&A

What are the physical and chemical properties of [3-Chloro-5-(4-morpholinylcarbonyl)phenyl]boronic acid (CAS: 957120-55-7)?

Answer

[3-Chloro-5-(4-morpholinylcarbonyl)phenyl]boronic acid
[3-Chloro-5-(4-morpholinylcarbonyl)phenyl]boronic acid is a crystalline solid with a molecular weight of approximately 323.28 g/mol. It has a low solubility in water but is soluble in organic solvents like methanol and acetonitrile. This compound exhibits moderate reactivity in organic synthesis, particularly in boronate ester formation. It is stable under standard storage conditions but should be protected from strong oxidizing agents and moisture.

About

English Name [3-Chloro-5-(4-morpholinylcarbonyl)phenyl]boronic acid
Molecular Formula C11H13BClNO4
Molecular Weight 269.49 g/mol
SMILES B(C1=CC(=CC(=C1)Cl)C(=O)N2CCOCC2)(O)O
InChIKey ZXFMDBGQTVWQQY-UHFFFAOYSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

How is [3-Chloro-5-(4-morpholinylcarbonyl)phenyl]boronic acid (CAS: 957120-55-7) typically synthesized?

[3-Chloro-5-(4-morpholinylcarbonyl)phenyl]boronic acid is typically synthesized by coupling 3-chloro...

Compound Q&A

What industries use [3-Chloro-5-(4-morpholinylcarbonyl)phenyl]boronic acid (CAS: 957120-55-7)?

[3-Chloro-5-(4-morpholinylcarbonyl)phenyl]boronic acid finds applications in various industries, par...

Compound Q&A

What precautions should be taken when handling [3-Chloro-5-(4-morpholinylcarbonyl)phenyl]boronic acid (CAS: 957120-55-7)?

When handling [3-Chloro-5-(4-morpholinylcarbonyl)phenyl]boronic acid, it is essential to use appropr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...