Compound Q&A

How is [3-Chloro-5-(4-morpholinylcarbonyl)phenyl]boronic acid (CAS: 957120-55-7) typically synthesized?

Answer

[3-Chloro-5-(4-morpholinylcarbonyl)phenyl]boronic acid
[3-Chloro-5-(4-morpholinylcarbonyl)phenyl]boronic acid is typically synthesized by coupling 3-chlorophenylboronic acid with 4-(carbonyl)-4-morpholinyl boronic acid in the presence of a palladium catalyst (e.g., Pd(PPh3)4) and a base (e.g., potassium carbonate). The reaction is carried out in an organic solvent like toluene or dioxane at elevated temperatures. High selectivity and yields can be achieved under optimized conditions.

About

English Name [3-Chloro-5-(4-morpholinylcarbonyl)phenyl]boronic acid
Molecular Formula C11H13BClNO4
Molecular Weight 269.49 g/mol
SMILES B(C1=CC(=CC(=C1)Cl)C(=O)N2CCOCC2)(O)O
InChIKey ZXFMDBGQTVWQQY-UHFFFAOYSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of [3-Chloro-5-(4-morpholinylcarbonyl)phenyl]boronic acid (CAS: 957120-55-7)?

[3-Chloro-5-(4-morpholinylcarbonyl)phenyl]boronic acid is a crystalline solid with a molecular weigh...

Compound Q&A

What industries use [3-Chloro-5-(4-morpholinylcarbonyl)phenyl]boronic acid (CAS: 957120-55-7)?

[3-Chloro-5-(4-morpholinylcarbonyl)phenyl]boronic acid finds applications in various industries, par...

Compound Q&A

What precautions should be taken when handling [3-Chloro-5-(4-morpholinylcarbonyl)phenyl]boronic acid (CAS: 957120-55-7)?

When handling [3-Chloro-5-(4-morpholinylcarbonyl)phenyl]boronic acid, it is essential to use appropr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...