Compound Q&A

What precautions should be taken when handling 2,6-Dichloro-4-(trifluoromethyl)nicotinic acid (CAS: 503437-19-2)?

Answer

2,6-Dichloro-4-(trifluoromethyl)nicotinic acid
When handling 2,6-Dichloro-4-(trifluoromethyl)nicotinic acid (CAS: 503437-19-2), it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. This compound should be handled in a well-ventilated area or a fume hood due to its potential to release harmful fumes. Spills should be immediately neutralized with an appropriate absorbent and disposed of according to local regulations. Always consult the Safety Data Sheet (SDS) for specific handling and storage guidelines.

About

English Name 2,6-Dichloro-4-(trifluoromethyl)nicotinic acid
Molecular Formula C7H2Cl2F3NO2
Molecular Weight 260 g/mol
SMILES O=C(O)C1=C(Cl)N=C(Cl)C=C1C(F)(F)F
InChIKey PZBCYMXYIZQNFE-UHFFFAOYSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,6-Dichloro-4-(trifluoromethyl)nicotinic acid (CAS: 503437-19-2)?

2,6-Dichloro-4-(trifluoromethyl)nicotinic acid (CAS: 503437-19-2) is a crystalline solid with a mole...

Compound Q&A

How is 2,6-Dichloro-4-(trifluoromethyl)nicotinic acid (CAS: 503437-19-2) typically synthesized?

2,6-Dichloro-4-(trifluoromethyl)nicotinic acid is typically synthesized via the condensation of 2,6-...

Compound Q&A

What industries use 2,6-Dichloro-4-(trifluoromethyl)nicotinic acid (CAS: 503437-19-2)?

2,6-Dichloro-4-(trifluoromethyl)nicotinic acid (CAS: 503437-19-2) finds application in the pharmaceu...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...