Compound Q&A

What are the physical and chemical properties of 2,6-Dichloro-4-(trifluoromethyl)nicotinic acid (CAS: 503437-19-2)?

Answer

2,6-Dichloro-4-(trifluoromethyl)nicotinic acid
2,6-Dichloro-4-(trifluoromethyl)nicotinic acid (CAS: 503437-19-2) is a crystalline solid with a molecular weight of approximately 306.02 g/mol. It has limited water solubility in the range of 0.02 g/100 mL at 25°C. This compound is known for its high reactivity, particularly in nucleophilic substitution reactions. It is also stable under normal conditions but requires careful handling to avoid decomposition in the presence of strong bases.

About

English Name 2,6-Dichloro-4-(trifluoromethyl)nicotinic acid
Molecular Formula C7H2Cl2F3NO2
Molecular Weight 259.998 g/mol
SMILES O=C(O)C1=C(Cl)N=C(Cl)C=C1C(F)(F)F
InChIKey PZBCYMXYIZQNFE-UHFFFAOYSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

How is 2,6-Dichloro-4-(trifluoromethyl)nicotinic acid (CAS: 503437-19-2) typically synthesized?

2,6-Dichloro-4-(trifluoromethyl)nicotinic acid is typically synthesized via the condensation of 2,6-...

Compound Q&A

What industries use 2,6-Dichloro-4-(trifluoromethyl)nicotinic acid (CAS: 503437-19-2)?

2,6-Dichloro-4-(trifluoromethyl)nicotinic acid (CAS: 503437-19-2) finds application in the pharmaceu...

Compound Q&A

What precautions should be taken when handling 2,6-Dichloro-4-(trifluoromethyl)nicotinic acid (CAS: 503437-19-2)?

When handling 2,6-Dichloro-4-(trifluoromethyl)nicotinic acid (CAS: 503437-19-2), it is essential to ...

Compound Q&A

How should 2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) be stored?

2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) should be stored in ...

615-45-22-Methylbenzene-1,4-...
Compound Q&A

Is (1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide (CAS: 132747-20-7) safe?

(1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide is generally considered sa...

132747-20-7(1S,4S)-2,5-Diazabic...
Compound Q&A

What industries use (6-Chloropyridazin-3-YL)methanamine (CAS: 871826-15-2)?

(6-Chloropyridazin-3-YL)methanamine finds applications in the pharmaceutical ind...

871826-15-2(6-Chloropyridazin-3...
Compound Q&A

What are the main uses of 2-Fluoro-3-methylphenol (CAS: 77772-72-6)?

2-Fluoro-3-methylphenol is primarily used in the synthesis of pharmaceuticals, p...

77772-72-62-Fluoro-3-methylphe...