Compound Q&A

What industries use 2,6-Dichloro-4-(trifluoromethyl)nicotinic acid (CAS: 503437-19-2)?

Answer

2,6-Dichloro-4-(trifluoromethyl)nicotinic acid
2,6-Dichloro-4-(trifluoromethyl)nicotinic acid (CAS: 503437-19-2) finds application in the pharmaceutical industry for the synthesis of certain drug intermediates. It is also used in the semiconductor industry as a precursor in the production of electronic materials and in the polymer industry for the development of advanced functional polymers.

About

English Name 2,6-Dichloro-4-(trifluoromethyl)nicotinic acid
Molecular Formula C7H2Cl2F3NO2
Molecular Weight 260 g/mol
SMILES O=C(O)C1=C(Cl)N=C(Cl)C=C1C(F)(F)F
InChIKey PZBCYMXYIZQNFE-UHFFFAOYSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,6-Dichloro-4-(trifluoromethyl)nicotinic acid (CAS: 503437-19-2)?

2,6-Dichloro-4-(trifluoromethyl)nicotinic acid (CAS: 503437-19-2) is a crystalline solid with a mole...

Compound Q&A

How is 2,6-Dichloro-4-(trifluoromethyl)nicotinic acid (CAS: 503437-19-2) typically synthesized?

2,6-Dichloro-4-(trifluoromethyl)nicotinic acid is typically synthesized via the condensation of 2,6-...

Compound Q&A

What precautions should be taken when handling 2,6-Dichloro-4-(trifluoromethyl)nicotinic acid (CAS: 503437-19-2)?

When handling 2,6-Dichloro-4-(trifluoromethyl)nicotinic acid (CAS: 503437-19-2), it is essential to ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...