Compound Q&A

What industries use 2,6-Dichloro-4-(trifluoromethyl)nicotinic acid (CAS: 503437-19-2)?

Answer

2,6-Dichloro-4-(trifluoromethyl)nicotinic acid
2,6-Dichloro-4-(trifluoromethyl)nicotinic acid (CAS: 503437-19-2) finds application in the pharmaceutical industry for the synthesis of certain drug intermediates. It is also used in the semiconductor industry as a precursor in the production of electronic materials and in the polymer industry for the development of advanced functional polymers.

About

English Name 2,6-Dichloro-4-(trifluoromethyl)nicotinic acid
Molecular Formula C7H2Cl2F3NO2
Molecular Weight 259.998 g/mol
SMILES O=C(O)C1=C(Cl)N=C(Cl)C=C1C(F)(F)F
InChIKey PZBCYMXYIZQNFE-UHFFFAOYSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,6-Dichloro-4-(trifluoromethyl)nicotinic acid (CAS: 503437-19-2)?

2,6-Dichloro-4-(trifluoromethyl)nicotinic acid (CAS: 503437-19-2) is a crystalline solid with a mole...

Compound Q&A

How is 2,6-Dichloro-4-(trifluoromethyl)nicotinic acid (CAS: 503437-19-2) typically synthesized?

2,6-Dichloro-4-(trifluoromethyl)nicotinic acid is typically synthesized via the condensation of 2,6-...

Compound Q&A

What precautions should be taken when handling 2,6-Dichloro-4-(trifluoromethyl)nicotinic acid (CAS: 503437-19-2)?

When handling 2,6-Dichloro-4-(trifluoromethyl)nicotinic acid (CAS: 503437-19-2), it is essential to ...

Compound Q&A

How should 2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) be stored?

2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) should be stored in ...

615-45-22-Methylbenzene-1,4-...
Compound Q&A

Is (1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide (CAS: 132747-20-7) safe?

(1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide is generally considered sa...

132747-20-7(1S,4S)-2,5-Diazabic...
Compound Q&A

What industries use (6-Chloropyridazin-3-YL)methanamine (CAS: 871826-15-2)?

(6-Chloropyridazin-3-YL)methanamine finds applications in the pharmaceutical ind...

871826-15-2(6-Chloropyridazin-3...
Compound Q&A

What are the main uses of 2-Fluoro-3-methylphenol (CAS: 77772-72-6)?

2-Fluoro-3-methylphenol is primarily used in the synthesis of pharmaceuticals, p...

77772-72-62-Fluoro-3-methylphe...