Compound Q&A

What precautions should be taken when handling 1,2-Benzisothiazole-3-carboxylic acid (CAS: 40991-34-2)?

Answer

1,2-Benzisothiazole-3-carboxylic acid
When handling 1,2-Benzisothiazole-3-carboxylic acid, it is crucial to use personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Ensure to work in a well-ventilated area, such as a fume hood, to avoid inhalation of the vapors. Spills should be cleaned up using appropriate absorbent materials, and the area should be thoroughly washed. Always refer to the Safety Data Sheet (SDS) for detailed safety guidelines and emergency procedures.

About

CAS No 40991-34-2
English Name 1,2-Benzisothiazole-3-carboxylic acid
Molecular Formula C8H5NO2S
Molecular Weight 179.2 g/mol
SMILES C1=CC=C2C(=C1)C(=NS2)C(=O)O
InChIKey KTORKRBAIRTBCP-UHFFFAOYSA-N
Last Updated: 2026-01-02 00:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,2-Benzisothiazole-3-carboxylic acid (CAS: 40991-34-2)?

1,2-Benzisothiazole-3-carboxylic acid is a crystalline solid with a molecular weight of approximatel...

Compound Q&A

How is 1,2-Benzisothiazole-3-carboxylic acid (CAS: 40991-34-2) typically synthesized?

1,2-Benzisothiazole-3-carboxylic acid is synthesized via the reaction of benzyl isothiocyanate with ...

Compound Q&A

What industries use 1,2-Benzisothiazole-3-carboxylic acid (CAS: 40991-34-2)?

1,2-Benzisothiazole-3-carboxylic acid is used in various industries due to its chemical reactivity. ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...