Compound Q&A

How is 1,2-Benzisothiazole-3-carboxylic acid (CAS: 40991-34-2) typically synthesized?

Answer

1,2-Benzisothiazole-3-carboxylic acid
1,2-Benzisothiazole-3-carboxylic acid is synthesized via the reaction of benzyl isothiocyanate with 1,2-benzenediol. This process typically requires a catalyst to enhance yield and selectivity. The reaction involves the substitution of the isothiocyanate group with a carboxylic acid group, resulting in a high-yield product with good purity.

About

CAS No 40991-34-2
English Name 1,2-Benzisothiazole-3-carboxylic acid
Molecular Formula C8H5NO2S
Molecular Weight 179.2 g/mol
SMILES C1=CC=C2C(=C1)C(=NS2)C(=O)O
InChIKey KTORKRBAIRTBCP-UHFFFAOYSA-N
Last Updated: 2026-01-02 00:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,2-Benzisothiazole-3-carboxylic acid (CAS: 40991-34-2)?

1,2-Benzisothiazole-3-carboxylic acid is a crystalline solid with a molecular weight of approximatel...

Compound Q&A

What industries use 1,2-Benzisothiazole-3-carboxylic acid (CAS: 40991-34-2)?

1,2-Benzisothiazole-3-carboxylic acid is used in various industries due to its chemical reactivity. ...

Compound Q&A

What precautions should be taken when handling 1,2-Benzisothiazole-3-carboxylic acid (CAS: 40991-34-2)?

When handling 1,2-Benzisothiazole-3-carboxylic acid, it is crucial to use personal protective equipm...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...