Compound Q&A

What industries use 1,2-Benzisothiazole-3-carboxylic acid (CAS: 40991-34-2)?

Answer

1,2-Benzisothiazole-3-carboxylic acid
1,2-Benzisothiazole-3-carboxylic acid is used in various industries due to its chemical reactivity. It is commonly employed in pharmaceuticals for the synthesis of drugs and intermediates, in polymers for stabilizing materials against degradation, and in sensors for detecting metal ions. Additionally, it is used in the semiconductor industry for its unique properties in chemical vapor deposition processes.

About

CAS No 40991-34-2
English Name 1,2-Benzisothiazole-3-carboxylic acid
Molecular Formula C8H5NO2S
Molecular Weight 179.2 g/mol
SMILES C1=CC=C2C(=C1)C(=NS2)C(=O)O
InChIKey KTORKRBAIRTBCP-UHFFFAOYSA-N
Last Updated: 2026-01-02 00:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,2-Benzisothiazole-3-carboxylic acid (CAS: 40991-34-2)?

1,2-Benzisothiazole-3-carboxylic acid is a crystalline solid with a molecular weight of approximatel...

Compound Q&A

How is 1,2-Benzisothiazole-3-carboxylic acid (CAS: 40991-34-2) typically synthesized?

1,2-Benzisothiazole-3-carboxylic acid is synthesized via the reaction of benzyl isothiocyanate with ...

Compound Q&A

What precautions should be taken when handling 1,2-Benzisothiazole-3-carboxylic acid (CAS: 40991-34-2)?

When handling 1,2-Benzisothiazole-3-carboxylic acid, it is crucial to use personal protective equipm...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...