Compound Q&A

What are the physical and chemical properties of 1,2-Benzisothiazole-3-carboxylic acid (CAS: 40991-34-2)?

Answer

1,2-Benzisothiazole-3-carboxylic acid
1,2-Benzisothiazole-3-carboxylic acid is a crystalline solid with a molecular weight of approximately 201.23 g/mol. It has limited water solubility, with a solubility of about 2.5 g/L at 25°C. The compound is known for its reactivity, particularly in nucleophilic substitution reactions. It can form complexes with various metal ions and is used in analytical chemistry for its reactivity and selectivity.

About

CAS No 40991-34-2
English Name 1,2-Benzisothiazole-3-carboxylic acid
Molecular Formula C8H5NO2S
Molecular Weight 179.2 g/mol
SMILES C1=CC=C2C(=C1)C(=NS2)C(=O)O
InChIKey KTORKRBAIRTBCP-UHFFFAOYSA-N
Last Updated: 2026-01-02 00:31

Related Q&A

Compound Q&A

How is 1,2-Benzisothiazole-3-carboxylic acid (CAS: 40991-34-2) typically synthesized?

1,2-Benzisothiazole-3-carboxylic acid is synthesized via the reaction of benzyl isothiocyanate with ...

Compound Q&A

What industries use 1,2-Benzisothiazole-3-carboxylic acid (CAS: 40991-34-2)?

1,2-Benzisothiazole-3-carboxylic acid is used in various industries due to its chemical reactivity. ...

Compound Q&A

What precautions should be taken when handling 1,2-Benzisothiazole-3-carboxylic acid (CAS: 40991-34-2)?

When handling 1,2-Benzisothiazole-3-carboxylic acid, it is crucial to use personal protective equipm...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...