Compound Q&A

What precautions should be taken when handling Ethyl 2,4-dioxo-4-(pyridin-2-yl)butanoate (CAS: 92288-93-2)?

Answer

Ethyl 2,4-dioxo-4-(pyridin-2-yl)butanoate
When handling Ethyl 2,4-dioxo-4-(pyridin-2-yl)butanoate (CAS: 92288-93-2), safety goggles and gloves are essential. Work should be conducted in a well-ventilated area or a fume hood to minimize exposure to the vapor. Spills should be cleaned up with appropriate PPE, and the material safety data sheet (MSDS) should be consulted for detailed safety information. Ensure proper storage in a secure, cool, and dry location away from incompatible materials.

About

CAS No 92288-93-2
English Name Ethyl 2,4-dioxo-4-(pyridin-2-yl)butanoate
Molecular Formula C11H11NO4
Molecular Weight 221.21 g/mol
SMILES CCOC(=O)C(=O)CC(=O)C1=CC=CC=N1
InChIKey FBIPIHMTJUPZJB-UHFFFAOYSA-N
Last Updated: 2026-01-02 00:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 2,4-dioxo-4-(pyridin-2-yl)butanoate (CAS: 92288-93-2)?

Ethyl 2,4-dioxo-4-(pyridin-2-yl)butanoate (CAS: 92288-93-2) is a crystalline compound with a molecul...

Compound Q&A

How is Ethyl 2,4-dioxo-4-(pyridin-2-yl)butanoate (CAS: 92288-93-2) typically synthesized?

Ethyl 2,4-dioxo-4-(pyridin-2-yl)butanoate (CAS: 92288-93-2) is typically synthesized via the condens...

Compound Q&A

What industries use Ethyl 2,4-dioxo-4-(pyridin-2-yl)butanoate (CAS: 92288-93-2)?

Ethyl 2,4-dioxo-4-(pyridin-2-yl)butanoate (CAS: 92288-93-2) finds applications in the pharmaceutical...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...