Compound Q&A

How is Ethyl 2,4-dioxo-4-(pyridin-2-yl)butanoate (CAS: 92288-93-2) typically synthesized?

Answer

Ethyl 2,4-dioxo-4-(pyridin-2-yl)butanoate
Ethyl 2,4-dioxo-4-(pyridin-2-yl)butanoate (CAS: 92288-93-2) is typically synthesized via the condensation of 2-bromopyridine with ethyl 2,4-dione butanoate using a catalytic amount of a base like sodium hydride. The reaction is carried out in an organic solvent such as dimethylformamide (DMF) under anhydrous conditions. The yield and selectivity are generally good, with minimal side products observed.

About

CAS No 92288-93-2
English Name Ethyl 2,4-dioxo-4-(pyridin-2-yl)butanoate
Molecular Formula C11H11NO4
Molecular Weight 221.21 g/mol
SMILES CCOC(=O)C(=O)CC(=O)C1=CC=CC=N1
InChIKey FBIPIHMTJUPZJB-UHFFFAOYSA-N
Last Updated: 2026-01-02 00:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 2,4-dioxo-4-(pyridin-2-yl)butanoate (CAS: 92288-93-2)?

Ethyl 2,4-dioxo-4-(pyridin-2-yl)butanoate (CAS: 92288-93-2) is a crystalline compound with a molecul...

Compound Q&A

What industries use Ethyl 2,4-dioxo-4-(pyridin-2-yl)butanoate (CAS: 92288-93-2)?

Ethyl 2,4-dioxo-4-(pyridin-2-yl)butanoate (CAS: 92288-93-2) finds applications in the pharmaceutical...

Compound Q&A

What precautions should be taken when handling Ethyl 2,4-dioxo-4-(pyridin-2-yl)butanoate (CAS: 92288-93-2)?

When handling Ethyl 2,4-dioxo-4-(pyridin-2-yl)butanoate (CAS: 92288-93-2), safety goggles and gloves...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...