Compound Q&A

What industries use Ethyl 2,4-dioxo-4-(pyridin-2-yl)butanoate (CAS: 92288-93-2)?

Answer

Ethyl 2,4-dioxo-4-(pyridin-2-yl)butanoate
Ethyl 2,4-dioxo-4-(pyridin-2-yl)butanoate (CAS: 92288-93-2) finds applications in the pharmaceutical industry, where it serves as a precursor for drug synthesis and as a building block for complex molecules. It is also used in the polymer industry for the development of functional polymers with specific properties. Additionally, it has potential uses in sensors and semiconductors due to its unique chemical structure.

About

CAS No 92288-93-2
English Name Ethyl 2,4-dioxo-4-(pyridin-2-yl)butanoate
Molecular Formula C11H11NO4
Molecular Weight 221.21 g/mol
SMILES CCOC(=O)C(=O)CC(=O)C1=CC=CC=N1
InChIKey FBIPIHMTJUPZJB-UHFFFAOYSA-N
Last Updated: 2026-01-02 00:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 2,4-dioxo-4-(pyridin-2-yl)butanoate (CAS: 92288-93-2)?

Ethyl 2,4-dioxo-4-(pyridin-2-yl)butanoate (CAS: 92288-93-2) is a crystalline compound with a molecul...

Compound Q&A

How is Ethyl 2,4-dioxo-4-(pyridin-2-yl)butanoate (CAS: 92288-93-2) typically synthesized?

Ethyl 2,4-dioxo-4-(pyridin-2-yl)butanoate (CAS: 92288-93-2) is typically synthesized via the condens...

Compound Q&A

What precautions should be taken when handling Ethyl 2,4-dioxo-4-(pyridin-2-yl)butanoate (CAS: 92288-93-2)?

When handling Ethyl 2,4-dioxo-4-(pyridin-2-yl)butanoate (CAS: 92288-93-2), safety goggles and gloves...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...