Compound Q&A

What are the physical and chemical properties of Ethyl 2,4-dioxo-4-(pyridin-2-yl)butanoate (CAS: 92288-93-2)?

Answer

Ethyl 2,4-dioxo-4-(pyridin-2-yl)butanoate
Ethyl 2,4-dioxo-4-(pyridin-2-yl)butanoate (CAS: 92288-93-2) is a crystalline compound with a molecular weight of approximately 218.18 g/mol. It is slightly soluble in water but highly soluble in organic solvents like methanol and dichloromethane. The compound has a high reactivity due to the presence of the 2,4-dioxo group and the pyridin-2-yl moiety, making it susceptible to nucleophilic and electrophilic reactions.

About

CAS No 92288-93-2
English Name Ethyl 2,4-dioxo-4-(pyridin-2-yl)butanoate
Molecular Formula C11H11NO4
Molecular Weight 221.21 g/mol
SMILES CCOC(=O)C(=O)CC(=O)C1=CC=CC=N1
InChIKey FBIPIHMTJUPZJB-UHFFFAOYSA-N
Last Updated: 2026-01-02 00:31

Related Q&A

Compound Q&A

How is Ethyl 2,4-dioxo-4-(pyridin-2-yl)butanoate (CAS: 92288-93-2) typically synthesized?

Ethyl 2,4-dioxo-4-(pyridin-2-yl)butanoate (CAS: 92288-93-2) is typically synthesized via the condens...

Compound Q&A

What industries use Ethyl 2,4-dioxo-4-(pyridin-2-yl)butanoate (CAS: 92288-93-2)?

Ethyl 2,4-dioxo-4-(pyridin-2-yl)butanoate (CAS: 92288-93-2) finds applications in the pharmaceutical...

Compound Q&A

What precautions should be taken when handling Ethyl 2,4-dioxo-4-(pyridin-2-yl)butanoate (CAS: 92288-93-2)?

When handling Ethyl 2,4-dioxo-4-(pyridin-2-yl)butanoate (CAS: 92288-93-2), safety goggles and gloves...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...