Compound Q&A

What precautions should be taken when handling (2R)-1-(Isopropylamino)-3-[4-(2-methoxyethyl)phenoxy]-2-propanol (CAS: 81024-43-3)?

Answer

(2R)-1-(Isopropylamino)-3-[4-(2-methoxyethyl)phenoxy]-2-propanol
Handling this compound requires appropriate personal protective equipment (PPE), including gloves, goggles, and a lab coat. It should be conducted in a well-ventilated area or a fume hood to prevent inhaling fumes. Spills should be handled by the appropriate safety protocols, and the Material Safety Data Sheet (MSDS) should be consulted for detailed instructions. Ensure proper storage in a cool, dry place away from direct sunlight and flammable materials.

About

CAS No 81024-43-3
English Name (2R)-1-(Isopropylamino)-3-[4-(2-methoxyethyl)phenoxy]-2-propanol
Molecular Formula C15H25NO3
Molecular Weight 267.37 g/mol
SMILES COCCc1ccc(OC[C@H](O)CNC(C)C)cc1
InChIKey IUBSYMUCCVWXPE-CQSZACIVSA-N
Last Updated: 2026-01-02 00:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2R)-1-(Isopropylamino)-3-[4-(2-methoxyethyl)phenoxy]-2-propanol (CAS: 81024-43-3)?

The compound (2R)-1-(Isopropylamino)-3-[4-(2-methoxyethyl)phenoxy]-2-propanol has a crystalline form...

Compound Q&A

How is (2R)-1-(Isopropylamino)-3-[4-(2-methoxyethyl)phenoxy]-2-propanol (CAS: 81024-43-3) typically synthesized?

The compound is typically synthesized via a multi-step process involving the formation of a phenol d...

Compound Q&A

What industries use (2R)-1-(Isopropylamino)-3-[4-(2-methoxyethyl)phenoxy]-2-propanol (CAS: 81024-43-3)?

This compound is primarily used in the pharmaceutical industry for the synthesis of certain drugs. I...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...