Compound Q&A

What are the physical and chemical properties of (2R)-1-(Isopropylamino)-3-[4-(2-methoxyethyl)phenoxy]-2-propanol (CAS: 81024-43-3)?

Answer

(2R)-1-(Isopropylamino)-3-[4-(2-methoxyethyl)phenoxy]-2-propanol
The compound (2R)-1-(Isopropylamino)-3-[4-(2-methoxyethyl)phenoxy]-2-propanol has a crystalline form and a molecular weight of approximately 344.45 g/mol. It is slightly soluble in water and highly soluble in organic solvents. The compound is reactive towards nucleophiles and can undergo substitution reactions. It is stable under normal conditions but should be stored in a cool, dry place away from direct sunlight.

About

CAS No 81024-43-3
English Name (2R)-1-(Isopropylamino)-3-[4-(2-methoxyethyl)phenoxy]-2-propanol
Molecular Formula C15H25NO3
Molecular Weight 267.37 g/mol
SMILES COCCc1ccc(OC[C@H](O)CNC(C)C)cc1
InChIKey IUBSYMUCCVWXPE-CQSZACIVSA-N
Last Updated: 2026-01-02 00:31

Related Q&A

Compound Q&A

How is (2R)-1-(Isopropylamino)-3-[4-(2-methoxyethyl)phenoxy]-2-propanol (CAS: 81024-43-3) typically synthesized?

The compound is typically synthesized via a multi-step process involving the formation of a phenol d...

Compound Q&A

What industries use (2R)-1-(Isopropylamino)-3-[4-(2-methoxyethyl)phenoxy]-2-propanol (CAS: 81024-43-3)?

This compound is primarily used in the pharmaceutical industry for the synthesis of certain drugs. I...

Compound Q&A

What precautions should be taken when handling (2R)-1-(Isopropylamino)-3-[4-(2-methoxyethyl)phenoxy]-2-propanol (CAS: 81024-43-3)?

Handling this compound requires appropriate personal protective equipment (PPE), including gloves, g...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...