Compound Q&A

How is (2R)-1-(Isopropylamino)-3-[4-(2-methoxyethyl)phenoxy]-2-propanol (CAS: 81024-43-3) typically synthesized?

Answer

(2R)-1-(Isopropylamino)-3-[4-(2-methoxyethyl)phenoxy]-2-propanol
The compound is typically synthesized via a multi-step process involving the formation of a phenol derivative, followed by alkylation and amino substitution reactions. The synthesis involves the use of suitable catalysts to ensure high selectivity and yield. The exact method can vary, but the reaction conditions, such as temperature and solvent, are crucial for optimal results.

About

CAS No 81024-43-3
English Name (2R)-1-(Isopropylamino)-3-[4-(2-methoxyethyl)phenoxy]-2-propanol
Molecular Formula C15H25NO3
Molecular Weight 267.37 g/mol
SMILES COCCc1ccc(OC[C@H](O)CNC(C)C)cc1
InChIKey IUBSYMUCCVWXPE-CQSZACIVSA-N
Last Updated: 2026-01-02 00:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2R)-1-(Isopropylamino)-3-[4-(2-methoxyethyl)phenoxy]-2-propanol (CAS: 81024-43-3)?

The compound (2R)-1-(Isopropylamino)-3-[4-(2-methoxyethyl)phenoxy]-2-propanol has a crystalline form...

Compound Q&A

What industries use (2R)-1-(Isopropylamino)-3-[4-(2-methoxyethyl)phenoxy]-2-propanol (CAS: 81024-43-3)?

This compound is primarily used in the pharmaceutical industry for the synthesis of certain drugs. I...

Compound Q&A

What precautions should be taken when handling (2R)-1-(Isopropylamino)-3-[4-(2-methoxyethyl)phenoxy]-2-propanol (CAS: 81024-43-3)?

Handling this compound requires appropriate personal protective equipment (PPE), including gloves, g...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...