Compound Q&A

What industries use 2-Chloro-3-methylpyridine 1-oxide (CAS: 91668-83-6)?

Answer

2-Chloro-3-methylpyridine 1-oxide
2-Chloro-3-methylpyridine 1-oxide (CAS: 91668-83-6) is used in various industries, including pharmaceuticals, where it serves as a precursor for the synthesis of certain drugs. It also finds applications in the production of organic semiconductors and as a chemical intermediate in the development of sensors and polymers.

About

CAS No 91668-83-6
English Name 2-Chloro-3-methylpyridine 1-oxide
Molecular Formula C6H6ClNO
Molecular Weight 143.57 g/mol
SMILES CC1=C([N+](=CC=C1)[O-])Cl
InChIKey ZGHMADNNOPPAJO-UHFFFAOYSA-N
Last Updated: 2026-01-01 20:05

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Chloro-3-methylpyridine 1-oxide (CAS: 91668-83-6)?

2-Chloro-3-methylpyridine 1-oxide (CAS: 91668-83-6) is a crystalline solid with a molecular weight o...

Compound Q&A

How is 2-Chloro-3-methylpyridine 1-oxide (CAS: 91668-83-6) typically synthesized?

2-Chloro-3-methylpyridine 1-oxide (CAS: 91668-83-6) is typically synthesized through the chlorinatio...

Compound Q&A

What precautions should be taken when handling 2-Chloro-3-methylpyridine 1-oxide (CAS: 91668-83-6)?

When handling 2-Chloro-3-methylpyridine 1-oxide (CAS: 91668-83-6), it is crucial to use appropriate ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...