Compound Q&A

What are the physical and chemical properties of 2-Chloro-3-methylpyridine 1-oxide (CAS: 91668-83-6)?

Answer

2-Chloro-3-methylpyridine 1-oxide
2-Chloro-3-methylpyridine 1-oxide (CAS: 91668-83-6) is a crystalline solid with a molecular weight of approximately 182.6 g/mol. It has a melting point of around 125-127°C and is sparingly soluble in water but more soluble in organic solvents like ethanol and dichloromethane. This compound is moderately reactive with nucleophiles and can undergo substitution reactions.

About

CAS No 91668-83-6
English Name 2-Chloro-3-methylpyridine 1-oxide
Molecular Formula C6H6ClNO
Molecular Weight 143.57 g/mol
SMILES CC1=C([N+](=CC=C1)[O-])Cl
InChIKey ZGHMADNNOPPAJO-UHFFFAOYSA-N
Last Updated: 2026-01-01 20:05

Related Q&A

Compound Q&A

How is 2-Chloro-3-methylpyridine 1-oxide (CAS: 91668-83-6) typically synthesized?

2-Chloro-3-methylpyridine 1-oxide (CAS: 91668-83-6) is typically synthesized through the chlorinatio...

Compound Q&A

What industries use 2-Chloro-3-methylpyridine 1-oxide (CAS: 91668-83-6)?

2-Chloro-3-methylpyridine 1-oxide (CAS: 91668-83-6) is used in various industries, including pharmac...

Compound Q&A

What precautions should be taken when handling 2-Chloro-3-methylpyridine 1-oxide (CAS: 91668-83-6)?

When handling 2-Chloro-3-methylpyridine 1-oxide (CAS: 91668-83-6), it is crucial to use appropriate ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...