Compound Q&A

How is 2-Chloro-3-methylpyridine 1-oxide (CAS: 91668-83-6) typically synthesized?

Answer

2-Chloro-3-methylpyridine 1-oxide
2-Chloro-3-methylpyridine 1-oxide (CAS: 91668-83-6) is typically synthesized through the chlorination of 3-methylpyridine followed by oxidation. Commonly, this involves the use of chlorine gas in the presence of a suitable catalyst, such as iron chloride, and subsequent oxidation often employs peroxy compounds or air oxidation. The reaction yield is generally good, and the product can be isolated through recrystallization.

About

CAS No 91668-83-6
English Name 2-Chloro-3-methylpyridine 1-oxide
Molecular Formula C6H6ClNO
Molecular Weight 143.57 g/mol
SMILES CC1=C([N+](=CC=C1)[O-])Cl
InChIKey ZGHMADNNOPPAJO-UHFFFAOYSA-N
Last Updated: 2026-01-01 20:05

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Chloro-3-methylpyridine 1-oxide (CAS: 91668-83-6)?

2-Chloro-3-methylpyridine 1-oxide (CAS: 91668-83-6) is a crystalline solid with a molecular weight o...

Compound Q&A

What industries use 2-Chloro-3-methylpyridine 1-oxide (CAS: 91668-83-6)?

2-Chloro-3-methylpyridine 1-oxide (CAS: 91668-83-6) is used in various industries, including pharmac...

Compound Q&A

What precautions should be taken when handling 2-Chloro-3-methylpyridine 1-oxide (CAS: 91668-83-6)?

When handling 2-Chloro-3-methylpyridine 1-oxide (CAS: 91668-83-6), it is crucial to use appropriate ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...