Compound Q&A

What precautions should be taken when handling N,N'-Desethylene-N,N'-diformyl Levofloxacin (CAS: 151377-74-1)?

Answer

N,N'-Desethylene-N,N'-diformyl Levofloxacin
When handling N,N'-Desethylene-N,N'-diformyl Levofloxacin (CAS: 151377-74-1), it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a fume hood to minimize exposure. Spills should be cleaned up immediately using appropriate methods, and safety data sheets (SDS) should be consulted for detailed handling procedures and emergency information.

About

English Name N,N'-Desethylene-N,N'-diformyl Levofloxacin
Molecular Formula C18H18FN3O6
Molecular Weight 391.36 g/mol
SMILES CC1COC2=C3N1C=C(C(=O)C3=CC(=C2N(CCN(C)C=O)C=O)F)C(=O)O
InChIKey HTOKHJLTWLBPPN-UHFFFAOYSA-N
Last Updated: 2026-01-01 15:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of N,N'-Desethylene-N,N'-diformyl Levofloxacin (CAS: 151377-74-1)?

N,N'-Desethylene-N,N'-diformyl Levofloxacin (CAS: 151377-74-1) is a crystalline solid with a molecul...

Compound Q&A

How is N,N'-Desethylene-N,N'-diformyl Levofloxacin (CAS: 151377-74-1) typically synthesized?

N,N'-Desethylene-N,N'-diformyl Levofloxacin (CAS: 151377-74-1) is typically synthesized by formylati...

Compound Q&A

What industries use N,N'-Desethylene-N,N'-diformyl Levofloxacin (CAS: 151377-74-1)?

N,N'-Desethylene-N,N'-diformyl Levofloxacin (CAS: 151377-74-1) is primarily used in the pharmaceutic...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...