Compound Q&A

How is N,N'-Desethylene-N,N'-diformyl Levofloxacin (CAS: 151377-74-1) typically synthesized?

Answer

N,N'-Desethylene-N,N'-diformyl Levofloxacin
N,N'-Desethylene-N,N'-diformyl Levofloxacin (CAS: 151377-74-1) is typically synthesized by formylation of levofloxacin followed by desethylation. This process involves the use of formic acid and a Lewis acid catalyst in the presence of a suitable solvent. The yield is generally high, and the product can be isolated by recrystallization.

About

English Name N,N'-Desethylene-N,N'-diformyl Levofloxacin
Molecular Formula C18H18FN3O6
Molecular Weight 391.36 g/mol
SMILES CC1COC2=C3N1C=C(C(=O)C3=CC(=C2N(CCN(C)C=O)C=O)F)C(=O)O
InChIKey HTOKHJLTWLBPPN-UHFFFAOYSA-N
Last Updated: 2026-01-01 15:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of N,N'-Desethylene-N,N'-diformyl Levofloxacin (CAS: 151377-74-1)?

N,N'-Desethylene-N,N'-diformyl Levofloxacin (CAS: 151377-74-1) is a crystalline solid with a molecul...

Compound Q&A

What industries use N,N'-Desethylene-N,N'-diformyl Levofloxacin (CAS: 151377-74-1)?

N,N'-Desethylene-N,N'-diformyl Levofloxacin (CAS: 151377-74-1) is primarily used in the pharmaceutic...

Compound Q&A

What precautions should be taken when handling N,N'-Desethylene-N,N'-diformyl Levofloxacin (CAS: 151377-74-1)?

When handling N,N'-Desethylene-N,N'-diformyl Levofloxacin (CAS: 151377-74-1), it is essential to wea...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...