Compound Q&A

What are the physical and chemical properties of N,N'-Desethylene-N,N'-diformyl Levofloxacin (CAS: 151377-74-1)?

Answer

N,N'-Desethylene-N,N'-diformyl Levofloxacin
N,N'-Desethylene-N,N'-diformyl Levofloxacin (CAS: 151377-74-1) is a crystalline solid with a molecular weight of approximately 458.4 g/mol. It is slightly soluble in water and highly soluble in organic solvents like methanol and acetonitrile. Chemically, it is reactive towards nucleophiles and can undergo hydrolysis and reduction under certain conditions.

About

English Name N,N'-Desethylene-N,N'-diformyl Levofloxacin
Molecular Formula C18H18FN3O6
Molecular Weight 391.36 g/mol
SMILES CC1COC2=C3N1C=C(C(=O)C3=CC(=C2N(CCN(C)C=O)C=O)F)C(=O)O
InChIKey HTOKHJLTWLBPPN-UHFFFAOYSA-N
Last Updated: 2026-01-01 15:35

Related Q&A

Compound Q&A

How is N,N'-Desethylene-N,N'-diformyl Levofloxacin (CAS: 151377-74-1) typically synthesized?

N,N'-Desethylene-N,N'-diformyl Levofloxacin (CAS: 151377-74-1) is typically synthesized by formylati...

Compound Q&A

What industries use N,N'-Desethylene-N,N'-diformyl Levofloxacin (CAS: 151377-74-1)?

N,N'-Desethylene-N,N'-diformyl Levofloxacin (CAS: 151377-74-1) is primarily used in the pharmaceutic...

Compound Q&A

What precautions should be taken when handling N,N'-Desethylene-N,N'-diformyl Levofloxacin (CAS: 151377-74-1)?

When handling N,N'-Desethylene-N,N'-diformyl Levofloxacin (CAS: 151377-74-1), it is essential to wea...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...