Compound Q&A

What industries use (R)-Benzyl 3-benzylpiperazine-1-carboxylate hydrochloride (CAS: 1217753-37-1)?

Answer

(R)-Benzyl 3-benzylpiperazine-1-carboxylate hydrochloride
(R)-Benzyl 3-benzylpiperazine-1-carboxylate hydrochloride finds applications in various industries, primarily in pharmaceuticals and research. It serves as an intermediate in the synthesis of complex organic compounds and is used in the development of new drugs. Additionally, its use in polymer chemistry and as a sensor component is also being explored due to its functional groups and reactive nature.

About

English Name (R)-Benzyl 3-benzylpiperazine-1-carboxylate hydrochloride
Molecular Formula C19H23ClN2O2
Molecular Weight 346.8579999999999 g/mol
SMILES C1CN(CC(N1)CC2=CC=CC=C2)C(=O)OCC3=CC=CC=C3.Cl
InChIKey KQHBPBYETAJYMS-GMUIIQOCSA-N
Last Updated: 2026-01-01 15:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of (R)-Benzyl 3-benzylpiperazine-1-carboxylate hydrochloride (CAS: 1217753-37-1)?

(R)-Benzyl 3-benzylpiperazine-1-carboxylate hydrochloride is a white crystalline solid with a molecu...

Compound Q&A

How is (R)-Benzyl 3-benzylpiperazine-1-carboxylate hydrochloride (CAS: 1217753-37-1) typically synthesized?

(R)-Benzyl 3-benzylpiperazine-1-carboxylate hydrochloride can be synthesized via the coupling of ben...

Compound Q&A

What precautions should be taken when handling (R)-Benzyl 3-benzylpiperazine-1-carboxylate hydrochloride (CAS: 1217753-37-1)?

When handling (R)-Benzyl 3-benzylpiperazine-1-carboxylate hydrochloride, it is essential to wear app...

Compound Q&A

How is 3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride (CAS: 1187830-80-3) typically synthesized?

3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride is typically s...

1187830-80-33-(2-Bromoimidazo[2,...
Compound Q&A

How is 2-Isopropyl-1,3-dioxane-5-carboxylic acid (CAS: 116193-72-7) typically synthesized?

2-Isopropyl-1,3-dioxane-5-carboxylic acid is typically synthesized by the carbox...

116193-72-72-Isopropyl-1,3-diox...
Compound Q&A

What is Alisporivir (CAS: 254435-95-5)?

Alisporivir (CAS: 254435-95-5) is an antiviral medication used in the treatment ...

254435-95-5Alisporivir
Compound Q&A

What are the physical and chemical properties of [1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0)?

[1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0) is a crystalline compound with...

234-80-0[1,2,4]triazolo[3,4-...