Compound Q&A

What are the physical and chemical properties of (R)-Benzyl 3-benzylpiperazine-1-carboxylate hydrochloride (CAS: 1217753-37-1)?

Answer

(R)-Benzyl 3-benzylpiperazine-1-carboxylate hydrochloride
(R)-Benzyl 3-benzylpiperazine-1-carboxylate hydrochloride is a white crystalline solid with a molecular weight of approximately 418.42 g/mol. It has a low solubility in water but is soluble in organic solvents like DMSO and methanol. This compound is relatively stable under normal conditions but can hydrolyze in the presence of moisture. It is often used as a precursor in organic synthesis due to its reactive carboxylic acid group and piperazine moiety.

About

English Name (R)-Benzyl 3-benzylpiperazine-1-carboxylate hydrochloride
Molecular Formula C19H23ClN2O2
Molecular Weight 346.8579999999999 g/mol
SMILES C1CN(CC(N1)CC2=CC=CC=C2)C(=O)OCC3=CC=CC=C3.Cl
InChIKey KQHBPBYETAJYMS-GMUIIQOCSA-N
Last Updated: 2026-01-01 15:35

Related Q&A

Compound Q&A

How is (R)-Benzyl 3-benzylpiperazine-1-carboxylate hydrochloride (CAS: 1217753-37-1) typically synthesized?

(R)-Benzyl 3-benzylpiperazine-1-carboxylate hydrochloride can be synthesized via the coupling of ben...

Compound Q&A

What industries use (R)-Benzyl 3-benzylpiperazine-1-carboxylate hydrochloride (CAS: 1217753-37-1)?

(R)-Benzyl 3-benzylpiperazine-1-carboxylate hydrochloride finds applications in various industries, ...

Compound Q&A

What precautions should be taken when handling (R)-Benzyl 3-benzylpiperazine-1-carboxylate hydrochloride (CAS: 1217753-37-1)?

When handling (R)-Benzyl 3-benzylpiperazine-1-carboxylate hydrochloride, it is essential to wear app...

Compound Q&A

How is 3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride (CAS: 1187830-80-3) typically synthesized?

3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride is typically s...

1187830-80-33-(2-Bromoimidazo[2,...
Compound Q&A

How is 2-Isopropyl-1,3-dioxane-5-carboxylic acid (CAS: 116193-72-7) typically synthesized?

2-Isopropyl-1,3-dioxane-5-carboxylic acid is typically synthesized by the carbox...

116193-72-72-Isopropyl-1,3-diox...
Compound Q&A

What is Alisporivir (CAS: 254435-95-5)?

Alisporivir (CAS: 254435-95-5) is an antiviral medication used in the treatment ...

254435-95-5Alisporivir
Compound Q&A

What are the physical and chemical properties of [1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0)?

[1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0) is a crystalline compound with...

234-80-0[1,2,4]triazolo[3,4-...