Compound Q&A

How is (R)-Benzyl 3-benzylpiperazine-1-carboxylate hydrochloride (CAS: 1217753-37-1) typically synthesized?

Answer

(R)-Benzyl 3-benzylpiperazine-1-carboxylate hydrochloride
(R)-Benzyl 3-benzylpiperazine-1-carboxylate hydrochloride can be synthesized via the coupling of benzyl piperazine with benzyl chloroformate in the presence of a base like triethylamine. The reaction proceeds smoothly with good yield and selectivity, making it suitable for large-scale production. The hydrochloride salt is formed during this process, enhancing the compound's stability and solubility in aqueous solutions.

About

English Name (R)-Benzyl 3-benzylpiperazine-1-carboxylate hydrochloride
Molecular Formula C19H23ClN2O2
Molecular Weight 346.8579999999999 g/mol
SMILES C1CN(CC(N1)CC2=CC=CC=C2)C(=O)OCC3=CC=CC=C3.Cl
InChIKey KQHBPBYETAJYMS-GMUIIQOCSA-N
Last Updated: 2026-01-01 15:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of (R)-Benzyl 3-benzylpiperazine-1-carboxylate hydrochloride (CAS: 1217753-37-1)?

(R)-Benzyl 3-benzylpiperazine-1-carboxylate hydrochloride is a white crystalline solid with a molecu...

Compound Q&A

What industries use (R)-Benzyl 3-benzylpiperazine-1-carboxylate hydrochloride (CAS: 1217753-37-1)?

(R)-Benzyl 3-benzylpiperazine-1-carboxylate hydrochloride finds applications in various industries, ...

Compound Q&A

What precautions should be taken when handling (R)-Benzyl 3-benzylpiperazine-1-carboxylate hydrochloride (CAS: 1217753-37-1)?

When handling (R)-Benzyl 3-benzylpiperazine-1-carboxylate hydrochloride, it is essential to wear app...

Compound Q&A

How is 3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride (CAS: 1187830-80-3) typically synthesized?

3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride is typically s...

1187830-80-33-(2-Bromoimidazo[2,...
Compound Q&A

How is 2-Isopropyl-1,3-dioxane-5-carboxylic acid (CAS: 116193-72-7) typically synthesized?

2-Isopropyl-1,3-dioxane-5-carboxylic acid is typically synthesized by the carbox...

116193-72-72-Isopropyl-1,3-diox...
Compound Q&A

What is Alisporivir (CAS: 254435-95-5)?

Alisporivir (CAS: 254435-95-5) is an antiviral medication used in the treatment ...

254435-95-5Alisporivir
Compound Q&A

What are the physical and chemical properties of [1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0)?

[1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0) is a crystalline compound with...

234-80-0[1,2,4]triazolo[3,4-...