Compound Q&A

What are the physical and chemical properties of 2-Chloro-3-hydroxy-4-quinolinecarboxylic acid (CAS: 847547-91-5)?

Answer

2-Chloro-3-hydroxy-4-quinolinecarboxylic acid
2-Chloro-3-hydroxy-4-quinolinecarboxylic acid is a crystalline solid with a molecular weight of approximately 237.6 g/mol. It is slightly soluble in water and ethanol. The compound is known for its stability under normal conditions but can react with strong bases to form the corresponding salts. It has a pKa of about 5.5, indicating it is a weak acid.

About

English Name 2-Chloro-3-hydroxy-4-quinolinecarboxylic acid
Molecular Formula C10H6ClNO3
Molecular Weight 223.61 g/mol
SMILES c1ccc2c(c1)c(c(c(n2)Cl)O)C(=O)O
InChIKey RPGQCGYSROBDNQ-UHFFFAOYSA-N
Last Updated: 2026-01-01 15:34

Related Q&A

Compound Q&A

How is 2-Chloro-3-hydroxy-4-quinolinecarboxylic acid (CAS: 847547-91-5) typically synthesized?

2-Chloro-3-hydroxy-4-quinolinecarboxylic acid is typically synthesized through the chlorination of a...

Compound Q&A

What industries use 2-Chloro-3-hydroxy-4-quinolinecarboxylic acid (CAS: 847547-91-5)?

2-Chloro-3-hydroxy-4-quinolinecarboxylic acid finds applications in the pharmaceutical industry as a...

Compound Q&A

What precautions should be taken when handling 2-Chloro-3-hydroxy-4-quinolinecarboxylic acid (CAS: 847547-91-5)?

When handling 2-Chloro-3-hydroxy-4-quinolinecarboxylic acid, it is important to wear appropriate per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...