Compound Q&A

What industries use 1-(7-methoxy-4-quinolyl)-3-[6-(trifluoromethyl)-2-pyridyl]urea (CAS: 1384424-80-9)?

Answer

1-(7-methoxy-4-quinolyl)-3-[6-(trifluoromethyl)-2-pyridyl]urea
1-(7-methoxy-4-quinolyl)-3-[6-(trifluoromethyl)-2-pyridyl]urea is used in the pharmaceutical industry as an intermediate in the synthesis of pharmaceutical compounds. It is also utilized in the polymer industry for its stability and reactivity. Additionally, this compound can be employed in the development of sensors and as a functional molecule in the field of organic electronics.

About

English Name 1-(7-methoxy-4-quinolyl)-3-[6-(trifluoromethyl)-2-pyridyl]urea
Molecular Formula C17H13F3N4O2
Molecular Weight 362.31 g/mol
SMILES COc1ccc2c(c1)nccc2NC(=O)Nc1cccc(n1)C(F)(F)F
InChIKey VQPBIJGXSXEOCU-UHFFFAOYSA-N
Last Updated: 2026-01-01 15:34

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(7-methoxy-4-quinolyl)-3-[6-(trifluoromethyl)-2-pyridyl]urea (CAS: 1384424-80-9)?

1-(7-methoxy-4-quinolyl)-3-[6-(trifluoromethyl)-2-pyridyl]urea is a crystalline compound with a mole...

Compound Q&A

How is 1-(7-methoxy-4-quinolyl)-3-[6-(trifluoromethyl)-2-pyridyl]urea (CAS: 1384424-80-9) typically synthesized?

1-(7-methoxy-4-quinolyl)-3-[6-(trifluoromethyl)-2-pyridyl]urea can be synthesized by reacting 7-meth...

Compound Q&A

What precautions should be taken when handling 1-(7-methoxy-4-quinolyl)-3-[6-(trifluoromethyl)-2-pyridyl]urea (CAS: 1384424-80-9)?

When handling 1-(7-methoxy-4-quinolyl)-3-[6-(trifluoromethyl)-2-pyridyl]urea, it is essential to wea...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...