Compound Q&A

What are the physical and chemical properties of 1-(7-methoxy-4-quinolyl)-3-[6-(trifluoromethyl)-2-pyridyl]urea (CAS: 1384424-80-9)?

Answer

1-(7-methoxy-4-quinolyl)-3-[6-(trifluoromethyl)-2-pyridyl]urea
1-(7-methoxy-4-quinolyl)-3-[6-(trifluoromethyl)-2-pyridyl]urea is a crystalline compound with a molecular weight of approximately 469.4 g/mol. Its solubility in water is low, and it is more soluble in organic solvents such as dimethylformamide (DMF) and acetonitrile. The compound shows moderate reactivity towards nucleophiles and can undergo substitution reactions. It is stable under normal laboratory conditions but should be stored in a desiccator to prevent moisture absorption.

About

English Name 1-(7-methoxy-4-quinolyl)-3-[6-(trifluoromethyl)-2-pyridyl]urea
Molecular Formula C17H13F3N4O2
Molecular Weight 362.31 g/mol
SMILES COc1ccc2c(c1)nccc2NC(=O)Nc1cccc(n1)C(F)(F)F
InChIKey VQPBIJGXSXEOCU-UHFFFAOYSA-N
Last Updated: 2026-01-01 15:34

Related Q&A

Compound Q&A

How is 1-(7-methoxy-4-quinolyl)-3-[6-(trifluoromethyl)-2-pyridyl]urea (CAS: 1384424-80-9) typically synthesized?

1-(7-methoxy-4-quinolyl)-3-[6-(trifluoromethyl)-2-pyridyl]urea can be synthesized by reacting 7-meth...

Compound Q&A

What industries use 1-(7-methoxy-4-quinolyl)-3-[6-(trifluoromethyl)-2-pyridyl]urea (CAS: 1384424-80-9)?

1-(7-methoxy-4-quinolyl)-3-[6-(trifluoromethyl)-2-pyridyl]urea is used in the pharmaceutical industr...

Compound Q&A

What precautions should be taken when handling 1-(7-methoxy-4-quinolyl)-3-[6-(trifluoromethyl)-2-pyridyl]urea (CAS: 1384424-80-9)?

When handling 1-(7-methoxy-4-quinolyl)-3-[6-(trifluoromethyl)-2-pyridyl]urea, it is essential to wea...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...