Compound Q&A

What industries use 2-Methyl-2-proplyl (4-methyl-1,3-thiazol-2-yl)carbamate (CAS: 848472-44-6)?

Answer

2-Methyl-2-propanyl (4-methyl-1,3-thiazol-2-yl)carbamate
2-Methyl-2-proplyl (4-methyl-1,3-thiazol-2-yl)carbamate is used in the pharmaceutical industry for the synthesis of various drugs and intermediates. It also finds applications in the sensor industry due to its reactivity and ability to form stable complexes. Additionally, it is used in the semiconductor industry as a chemical vapor deposition (CVD) precursor for thiazole-based materials.

About

English Name 2-Methyl-2-propanyl (4-methyl-1,3-thiazol-2-yl)carbamate
Molecular Formula C9H14N2O2S
Molecular Weight 214.29 g/mol
SMILES O=C(OC(C)(C)C)NC1=NC(C)=CS1
InChIKey JGBZPLSFZVKDDV-UHFFFAOYSA-N
Last Updated: 2026-01-01 10:50

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl (4-methyl-1,3-thiazol-2-yl)carbamate (CAS: 848472-44-6)?

2-Methyl-2-propanyl (4-methyl-1,3-thiazol-2-yl)carbamate is a colorless to slightly yellowish liquid...

Compound Q&A

How is 2-Methyl-2-proplyl (4-methyl-1,3-thiazol-2-yl)carbamate (CAS: 848472-44-6) typically synthesized?

2-Methyl-2-proplyl (4-methyl-1,3-thiazol-2-yl)carbamate is typically synthesized by the reaction of ...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-proplyl (4-methyl-1,3-thiazol-2-yl)carbamate (CAS: 848472-44-6)?

When handling 2-Methyl-2-proplyl (4-methyl-1,3-thiazol-2-yl)carbamate, it is essential to wear appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...