Compound Q&A

How is 2-Methyl-2-proplyl (4-methyl-1,3-thiazol-2-yl)carbamate (CAS: 848472-44-6) typically synthesized?

Answer

2-Methyl-2-propanyl (4-methyl-1,3-thiazol-2-yl)carbamate
2-Methyl-2-proplyl (4-methyl-1,3-thiazol-2-yl)carbamate is typically synthesized by the reaction of 4-methylthiazole with N,N-dimethylformamide (DMF) and 2-methyl-2-propanol. The process involves condensation followed by the formation of the carbamate linkage. This compound can also be synthesized using microwave-assisted techniques to enhance reaction rate and yield. Catalysts such as 4-Aminopyridine can improve the reaction selectivity and yield.

About

English Name 2-Methyl-2-propanyl (4-methyl-1,3-thiazol-2-yl)carbamate
Molecular Formula C9H14N2O2S
Molecular Weight 214.29 g/mol
SMILES O=C(OC(C)(C)C)NC1=NC(C)=CS1
InChIKey JGBZPLSFZVKDDV-UHFFFAOYSA-N
Last Updated: 2026-01-01 10:50

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl (4-methyl-1,3-thiazol-2-yl)carbamate (CAS: 848472-44-6)?

2-Methyl-2-propanyl (4-methyl-1,3-thiazol-2-yl)carbamate is a colorless to slightly yellowish liquid...

Compound Q&A

What industries use 2-Methyl-2-proplyl (4-methyl-1,3-thiazol-2-yl)carbamate (CAS: 848472-44-6)?

2-Methyl-2-proplyl (4-methyl-1,3-thiazol-2-yl)carbamate is used in the pharmaceutical industry for t...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-proplyl (4-methyl-1,3-thiazol-2-yl)carbamate (CAS: 848472-44-6)?

When handling 2-Methyl-2-proplyl (4-methyl-1,3-thiazol-2-yl)carbamate, it is essential to wear appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...