Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl (4-methyl-1,3-thiazol-2-yl)carbamate (CAS: 848472-44-6)?

Answer

2-Methyl-2-propanyl (4-methyl-1,3-thiazol-2-yl)carbamate
2-Methyl-2-propanyl (4-methyl-1,3-thiazol-2-yl)carbamate is a colorless to slightly yellowish liquid at room temperature. Its molecular weight is approximately 234.33 g/mol. Solubility is moderate in water and soluble in organic solvents like ethanol and acetone. It is moderately reactive, particularly towards acidic or basic conditions, making it susceptible to hydrolysis and coupling reactions. It is stable under normal laboratory conditions but should be stored in a cool, dry place away from direct sunlight and heat sources.

About

English Name 2-Methyl-2-propanyl (4-methyl-1,3-thiazol-2-yl)carbamate
Molecular Formula C9H14N2O2S
Molecular Weight 214.29 g/mol
SMILES O=C(OC(C)(C)C)NC1=NC(C)=CS1
InChIKey JGBZPLSFZVKDDV-UHFFFAOYSA-N
Last Updated: 2026-01-01 10:50

Related Q&A

Compound Q&A

How is 2-Methyl-2-proplyl (4-methyl-1,3-thiazol-2-yl)carbamate (CAS: 848472-44-6) typically synthesized?

2-Methyl-2-proplyl (4-methyl-1,3-thiazol-2-yl)carbamate is typically synthesized by the reaction of ...

Compound Q&A

What industries use 2-Methyl-2-proplyl (4-methyl-1,3-thiazol-2-yl)carbamate (CAS: 848472-44-6)?

2-Methyl-2-proplyl (4-methyl-1,3-thiazol-2-yl)carbamate is used in the pharmaceutical industry for t...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-proplyl (4-methyl-1,3-thiazol-2-yl)carbamate (CAS: 848472-44-6)?

When handling 2-Methyl-2-proplyl (4-methyl-1,3-thiazol-2-yl)carbamate, it is essential to wear appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...