Compound Q&A

What industries use (3,4-Difluorophenyl)(hydroxy)acetic acid (CAS: 132741-29-8)?

Answer

(3,4-Difluorophenyl)(hydroxy)acetic acid
(3,4-Difluorophenyl)(hydroxy)acetic acid (CAS: 132741-29-8) is primarily used in the pharmaceutical industry, where it serves as a precursor for the synthesis of various active pharmaceutical ingredients. It also finds applications in the production of certain polymers and chemical sensors. Due to its unique chemical properties, it is occasionally used in the semiconductor industry for specific applications that require high purity and stability.

About

English Name (3,4-Difluorophenyl)(hydroxy)acetic acid
Molecular Formula C8H6F2O3
Molecular Weight 188.13 g/mol
SMILES C1=CC(=C(C=C1C(C(=O)O)O)F)F
InChIKey BKHXODARAOCNDJ-UHFFFAOYSA-N
Last Updated: 2026-01-01 10:50

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3,4-Difluorophenyl)(hydroxy)acetic acid (CAS: 132741-29-8)?

The (3,4-Difluorophenyl)(hydroxy)acetic acid (CAS: 132741-29-8) is a solid with a crystalline form. ...

Compound Q&A

How is (3,4-Difluorophenyl)(hydroxy)acetic acid (CAS: 132741-29-8) typically synthesized?

(3,4-Difluorophenyl)(hydroxy)acetic acid (CAS: 132741-29-8) can be synthesized through a multi-step ...

Compound Q&A

What precautions should be taken when handling (3,4-Difluorophenyl)(hydroxy)acetic acid (CAS: 132741-29-8)?

When handling (3,4-Difluorophenyl)(hydroxy)acetic acid (CAS: 132741-29-8), it is important to follow...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...