Compound Q&A

What are the physical and chemical properties of (3,4-Difluorophenyl)(hydroxy)acetic acid (CAS: 132741-29-8)?

Answer

(3,4-Difluorophenyl)(hydroxy)acetic acid
The (3,4-Difluorophenyl)(hydroxy)acetic acid (CAS: 132741-29-8) is a solid with a crystalline form. It has a molecular weight of approximately 198.07 g/mol and a melting point around 240°C. This compound is slightly soluble in water and less soluble in organic solvents. It is moderately reactive, particularly with bases and other nucleophiles. Proper handling and storage under controlled conditions are recommended to maintain its stability.

About

English Name (3,4-Difluorophenyl)(hydroxy)acetic acid
Molecular Formula C8H6F2O3
Molecular Weight 188.13 g/mol
SMILES C1=CC(=C(C=C1C(C(=O)O)O)F)F
InChIKey BKHXODARAOCNDJ-UHFFFAOYSA-N
Last Updated: 2026-01-01 10:50

Related Q&A

Compound Q&A

How is (3,4-Difluorophenyl)(hydroxy)acetic acid (CAS: 132741-29-8) typically synthesized?

(3,4-Difluorophenyl)(hydroxy)acetic acid (CAS: 132741-29-8) can be synthesized through a multi-step ...

Compound Q&A

What industries use (3,4-Difluorophenyl)(hydroxy)acetic acid (CAS: 132741-29-8)?

(3,4-Difluorophenyl)(hydroxy)acetic acid (CAS: 132741-29-8) is primarily used in the pharmaceutical ...

Compound Q&A

What precautions should be taken when handling (3,4-Difluorophenyl)(hydroxy)acetic acid (CAS: 132741-29-8)?

When handling (3,4-Difluorophenyl)(hydroxy)acetic acid (CAS: 132741-29-8), it is important to follow...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...