Compound Q&A

What precautions should be taken when handling Glutathione sodium (CAS: 20167-21-9)?

Answer

Glutathione sodium
When handling Glutathione sodium (CAS: 20167-21-9), it is essential to wear appropriate personal protective equipment (PPE), including gloves and safety goggles. Ensure that the substance is stored in a cool, dry place away from oxidizing agents. Spills should be handled with caution using appropriate absorbent materials. Always refer to the Safety Data Sheet (SDS) for specific handling and emergency procedures.

About

CAS No 20167-21-9
English Name Glutathione sodium
Molecular Formula C10H16N3NaO6S
Molecular Weight 329.31 g/mol
SMILES C(CC(=O)NC(CS)C(=O)NCC(=O)O)C(C(=O)[O-])N.[Na+]
InChIKey QWXDICNEPRTOLR-GEMLJDPKSA-M
Last Updated: 2026-01-01 10:50

Related Q&A

Compound Q&A

What are the physical and chemical properties of Glutathione sodium (CAS: 20167-21-9)?

Glutathione sodium (CAS: 20167-21-9) is a crystalline solid with a molecular weight of approximately...

Compound Q&A

How is Glutathione sodium (CAS: 20167-21-9) typically synthesized?

Glutathione sodium (CAS: 20167-21-9) is typically synthesized by reacting glutathione with sodium hy...

Compound Q&A

What industries use Glutathione sodium (CAS: 20167-21-9)?

Glutathione sodium (CAS: 20167-21-9) is widely used in the pharmaceutical industry for its antioxida...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...